C19H18F2N2O2 — CID 118733336
2-[4-[(2,4-difluorophenyl)methylamino]butyl]isoindole-1,3-dione (PubChem CID 118733336) has the molecular formula C19H18F2N2O2 and a molecular weight of 344.36 g/mol. Its IUPAC name is 2-[4-[(2,4-difluorophenyl)methylamino]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[(2,4-difluorophenyl)methylamino]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 118733336 |
| Molecular Formula | C19H18F2N2O2 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 2-[4-[(2,4-difluorophenyl)methylamino]butyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCNCc1ccc(F)cc1F |
| InChI | InChI=1S/C19H18F2N2O2/c20-14-8-7-13(17(21)11-14)12-22-9-3-4-10-23-18(24)15-5-1-2-6-16(15)19(23)25/h1-2,5-8,11,22H,3-4,9-10,12H2 |
| InChIKey | GCDDVKBHBCMYIE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|