C18H15ClFNO3 — CID 112787288
2-[4-(2-chloro-4-fluorophenoxy)butyl]isoindole-1,3-dione (PubChem CID 112787288) has the molecular formula C18H15ClFNO3 and a molecular weight of 347.77 g/mol. Its IUPAC name is 2-[4-(2-chloro-4-fluorophenoxy)butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-(2-chloro-4-fluorophenoxy)butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 112787288 |
| Molecular Formula | C18H15ClFNO3 |
| Molecular Weight | 347.77 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 2-[4-(2-chloro-4-fluorophenoxy)butyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCOc1ccc(F)cc1Cl |
| InChI | InChI=1S/C18H15ClFNO3/c19-15-11-12(20)7-8-16(15)24-10-4-3-9-21-17(22)13-5-1-2-6-14(13)18(21)23/h1-2,5-8,11H,3-4,9-10H2 |
| InChIKey | QMKSYNSDYMIJAZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.77 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|