C21H23N3O5 — CID 119128857
2-[4-[(2-ethoxy-5-nitrophenyl)methylamino]butyl]isoindole-1,3-dione (PubChem CID 119128857) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is 2-[4-[(2-ethoxy-5-nitrophenyl)methylamino]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[(2-ethoxy-5-nitrophenyl)methylamino]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 119128857 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 2-[4-[(2-ethoxy-5-nitrophenyl)methylamino]butyl]isoindole-1,3-dione |
| SMILES | CCOc1ccc([N+](=O)[O-])cc1CNCCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H23N3O5/c1-2-29-19-10-9-16(24(27)28)13-15(19)14-22-11-5-6-12-23-20(25)17-7-3-4-8-18(17)21(23)26/h3-4,7-10,13,22H,2,5-6,11-12,14H2,1H3 |
| InChIKey | WKKCNXLUPCGGGH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|