C25H26N4O2S — CID 26935330
2-[[benzyl(methyl)amino]methyl]-5-(2-methoxyphenyl)-4-(4-methoxyphenyl)-1,2,4-triazole-3-thione (PubChem CID 26935330) has the molecular formula C25H26N4O2S and a molecular weight of 446.58 g/mol. Its IUPAC name is 2-[[benzyl(methyl)amino]methyl]-5-(2-methoxyphenyl)-4-(4-methoxyphenyl)-1,2,4-triazole-3-thione.
| Compound Name | 2-[[benzyl(methyl)amino]methyl]-5-(2-methoxyphenyl)-4-(4-methoxyphenyl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 26935330 |
| Molecular Formula | C25H26N4O2S |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 2-[[benzyl(methyl)amino]methyl]-5-(2-methoxyphenyl)-4-(4-methoxyphenyl)-1,2,4-triazole-3-thione |
| SMILES | COc1ccc(-n2c(-c3ccccc3OC)nn(CN(C)Cc3ccccc3)c2=S)cc1 |
| InChI | InChI=1S/C25H26N4O2S/c1-27(17-19-9-5-4-6-10-19)18-28-25(32)29(20-13-15-21(30-2)16-14-20)24(26-28)22-11-7-8-12-23(22)31-3/h4-16H,17-18H2,1-3H3 |
| InChIKey | MDDHKIOTWWZEFN-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 44.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|