C25H24FN5O2S — CID 42122122
1-(4-fluorophenyl)-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]-5-thiophen-2-yl-1,2,4-triazole-3-carboxamide (PubChem CID 42122122) has the molecular formula C25H24FN5O2S and a molecular weight of 477.57 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]-5-thiophen-2-yl-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]-5-thiophen-2-yl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 42122122 |
| Molecular Formula | C25H24FN5O2S |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 1-(4-fluorophenyl)-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]-5-thiophen-2-yl-1,2,4-triazole-3-carboxamide |
| SMILES | CN(Cc1ccc(N2CCOCC2)cc1)C(=O)c1nc(-c2cccs2)n(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C25H24FN5O2S/c1-29(17-18-4-8-20(9-5-18)30-12-14-33-15-13-30)25(32)23-27-24(22-3-2-16-34-22)31(28-23)21-10-6-19(26)7-11-21/h2-11,16H,12-15,17H2,1H3 |
| InChIKey | PPHQDLZUBXGNGA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|