C19H19FN4OS — CID 30949855
N-ethyl-1-(4-fluorophenyl)-N-(2-methylprop-2-enyl)-5-thiophen-2-yl-1,2,4-triazole-3-carboxamide (PubChem CID 30949855) has the molecular formula C19H19FN4OS and a molecular weight of 370.45 g/mol. Its IUPAC name is N-ethyl-1-(4-fluorophenyl)-N-(2-methylprop-2-enyl)-5-thiophen-2-yl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-ethyl-1-(4-fluorophenyl)-N-(2-methylprop-2-enyl)-5-thiophen-2-yl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 30949855 |
| Molecular Formula | C19H19FN4OS |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | N-ethyl-1-(4-fluorophenyl)-N-(2-methylprop-2-enyl)-5-thiophen-2-yl-1,2,4-triazole-3-carboxamide |
| SMILES | C=C(C)CN(CC)C(=O)c1nc(-c2cccs2)n(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C19H19FN4OS/c1-4-23(12-13(2)3)19(25)17-21-18(16-6-5-11-26-16)24(22-17)15-9-7-14(20)8-10-15/h5-11H,2,4,12H2,1,3H3 |
| InChIKey | PPUQJLHJGZRHRJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|