C20H24N4O2S — CID 55464751
3-[[methyl-[(4-piperidin-1-ylphenyl)methyl]amino]methyl]-5-thiophen-2-yl-1,3,4-oxadiazol-2-one (PubChem CID 55464751) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is 3-[[methyl-[(4-piperidin-1-ylphenyl)methyl]amino]methyl]-5-thiophen-2-yl-1,3,4-oxadiazol-2-one.
| Compound Name | 3-[[methyl-[(4-piperidin-1-ylphenyl)methyl]amino]methyl]-5-thiophen-2-yl-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 55464751 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 3-[[methyl-[(4-piperidin-1-ylphenyl)methyl]amino]methyl]-5-thiophen-2-yl-1,3,4-oxadiazol-2-one |
| SMILES | CN(Cc1ccc(N2CCCCC2)cc1)Cn1nc(-c2cccs2)oc1=O |
| InChI | InChI=1S/C20H24N4O2S/c1-22(15-24-20(25)26-19(21-24)18-6-5-13-27-18)14-16-7-9-17(10-8-16)23-11-3-2-4-12-23/h5-10,13H,2-4,11-12,14-15H2,1H3 |
| InChIKey | SKNGXVGTMZUUQM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 54.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|