C19H19N5O5S — CID 24514739
3-[3-[4-(4-nitrophenyl)piperazin-1-yl]-3-oxopropyl]-5-thiophen-2-yl-1,3,4-oxadiazol-2-one (PubChem CID 24514739) has the molecular formula C19H19N5O5S and a molecular weight of 429.46 g/mol. Its IUPAC name is 3-[3-[4-(4-nitrophenyl)piperazin-1-yl]-3-oxopropyl]-5-thiophen-2-yl-1,3,4-oxadiazol-2-one.
| Compound Name | 3-[3-[4-(4-nitrophenyl)piperazin-1-yl]-3-oxopropyl]-5-thiophen-2-yl-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 24514739 |
| Molecular Formula | C19H19N5O5S |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 3-[3-[4-(4-nitrophenyl)piperazin-1-yl]-3-oxopropyl]-5-thiophen-2-yl-1,3,4-oxadiazol-2-one |
| SMILES | O=C(CCn1nc(-c2cccs2)oc1=O)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C19H19N5O5S/c25-17(7-8-23-19(26)29-18(20-23)16-2-1-13-30-16)22-11-9-21(10-12-22)14-3-5-15(6-4-14)24(27)28/h1-6,13H,7-12H2 |
| InChIKey | HYJDVSVZWQOFOV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 114.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|