C21H20N4O5S2 — CID 27775312
[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl] 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate (PubChem CID 27775312) has the molecular formula C21H20N4O5S2 and a molecular weight of 472.55 g/mol. Its IUPAC name is [2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl] 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate.
| Compound Name | [2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl] 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate |
|---|---|
| PubChem CID | 27775312 |
| Molecular Formula | C21H20N4O5S2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | [2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl] 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate |
| SMILES | O=C(Cc1csc(-c2cccs2)n1)OCC(=O)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C21H20N4O5S2/c26-19(13-30-20(27)12-15-14-32-21(22-15)18-2-1-11-31-18)24-9-7-23(8-10-24)16-3-5-17(6-4-16)25(28)29/h1-6,11,14H,7-10,12-13H2 |
| InChIKey | JKBHHUAOGPZFII-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 105.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|