C23H26N4O5 — CID 98177219
(1R,2S,6S,7R)-4-[3-[4-(4-nitrophenyl)piperazin-1-yl]-3-oxopropyl]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione (PubChem CID 98177219) has the molecular formula C23H26N4O5 and a molecular weight of 438.48 g/mol. Its IUPAC name is (1R,2S,6S,7R)-4-[3-[4-(4-nitrophenyl)piperazin-1-yl]-3-oxopropyl]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione.
| Compound Name | (1R,2S,6S,7R)-4-[3-[4-(4-nitrophenyl)piperazin-1-yl]-3-oxopropyl]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 98177219 |
| Molecular Formula | C23H26N4O5 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | (1R,2S,6S,7R)-4-[3-[4-(4-nitrophenyl)piperazin-1-yl]-3-oxopropyl]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
| SMILES | O=C(CCN1C(=O)[C@@H]2[C@@H](C1=O)[C@H]1C=C[C@H]2CC1)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C23H26N4O5/c28-19(25-13-11-24(12-14-25)17-5-7-18(8-6-17)27(31)32)9-10-26-22(29)20-15-1-2-16(4-3-15)21(20)23(26)30/h1-2,5-8,15-16,20-21H,3-4,9-14H2/t15-,16-,20-,21-/m0/s1 |
| InChIKey | XTTZGPCMYQSQLO-LRGYGIHKSA-N |
| XLogP | 1.83 |
| TPSA | 104.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|