C19H15N5O7S — CID 24522594
1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-(2-oxo-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)propanoate (PubChem CID 24522594) has the molecular formula C19H15N5O7S and a molecular weight of 457.42 g/mol. Its IUPAC name is 1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-(2-oxo-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)propanoate.
| Compound Name | 1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-(2-oxo-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)propanoate |
|---|---|
| PubChem CID | 24522594 |
| Molecular Formula | C19H15N5O7S |
| Molecular Weight | 457.42 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | 1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-(2-oxo-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)propanoate |
| SMILES | CC(OC(=O)CCn1nc(-c2cccs2)oc1=O)c1nnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C19H15N5O7S/c1-11(16-20-21-17(30-16)12-4-6-13(7-5-12)24(27)28)29-15(25)8-9-23-19(26)31-18(22-23)14-3-2-10-32-14/h2-7,10-11H,8-9H2,1H3 |
| InChIKey | ULNHMDCLNBXZNC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 156.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|