C22H19N5O6 — CID 55427986
1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]propanoate (PubChem CID 55427986) has the molecular formula C22H19N5O6 and a molecular weight of 449.42 g/mol. Its IUPAC name is 1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]propanoate.
| Compound Name | 1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]propanoate |
|---|---|
| PubChem CID | 55427986 |
| Molecular Formula | C22H19N5O6 |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]propanoate |
| SMILES | Cc1ccc(-c2nnc(CCC(=O)OC(C)c3nnc(-c4ccc([N+](=O)[O-])cc4)o3)o2)cc1 |
| InChI | InChI=1S/C22H19N5O6/c1-13-3-5-15(6-4-13)21-25-23-18(32-21)11-12-19(28)31-14(2)20-24-26-22(33-20)16-7-9-17(10-8-16)27(29)30/h3-10,14H,11-12H2,1-2H3 |
| InChIKey | MCCAXYUHJVSIEE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 147.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|