C18H21N3O5 — CID 46824302
1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-cyclopentylpropanoate (PubChem CID 46824302) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is 1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-cyclopentylpropanoate.
| Compound Name | 1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-cyclopentylpropanoate |
|---|---|
| PubChem CID | 46824302 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-cyclopentylpropanoate |
| SMILES | CC(OC(=O)CCC1CCCC1)c1nnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C18H21N3O5/c1-12(25-16(22)11-6-13-4-2-3-5-13)17-19-20-18(26-17)14-7-9-15(10-8-14)21(23)24/h7-10,12-13H,2-6,11H2,1H3 |
| InChIKey | HMNCTKAXWNXYPR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 108.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|