C20H17N3O7 — CID 7715664
[(1R)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl] 2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetate (PubChem CID 7715664) has the molecular formula C20H17N3O7 and a molecular weight of 411.37 g/mol. Its IUPAC name is [(1R)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl] 2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetate.
| Compound Name | [(1R)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl] 2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetate |
|---|---|
| PubChem CID | 7715664 |
| Molecular Formula | C20H17N3O7 |
| Molecular Weight | 411.37 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | [(1R)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl] 2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetate |
| SMILES | C[C@@H](OC(=O)Cc1ccc2c(c1)OCCO2)c1nnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C20H17N3O7/c1-12(19-21-22-20(30-19)14-3-5-15(6-4-14)23(25)26)29-18(24)11-13-2-7-16-17(10-13)28-9-8-27-16/h2-7,10,12H,8-9,11H2,1H3/t12-/m1/s1 |
| InChIKey | LNNGDPRMYMPVPP-GFCCVEGCSA-N |
| XLogP | 3.26 |
| TPSA | 126.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|