C19H15N5O6S — CID 55424913
1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)propanoate (PubChem CID 55424913) has the molecular formula C19H15N5O6S and a molecular weight of 441.43 g/mol. Its IUPAC name is 1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)propanoate.
| Compound Name | 1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)propanoate |
|---|---|
| PubChem CID | 55424913 |
| Molecular Formula | C19H15N5O6S |
| Molecular Weight | 441.43 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | 1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)propanoate |
| SMILES | CC(OC(=O)CCc1nc(-c2ccsc2)no1)c1nnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C19H15N5O6S/c1-11(18-21-22-19(29-18)12-2-4-14(5-3-12)24(26)27)28-16(25)7-6-15-20-17(23-30-15)13-8-9-31-10-13/h2-5,8-11H,6-7H2,1H3 |
| InChIKey | SWUXAMZCKHLHOS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 147.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|