C10H13N3O2S — CID 95849400
3-[(2S)-2-aminobutyl]-5-thiophen-2-yl-1,3,4-oxadiazol-2-one (PubChem CID 95849400) has the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. Its IUPAC name is 3-[(2S)-2-aminobutyl]-5-thiophen-2-yl-1,3,4-oxadiazol-2-one.
| Compound Name | 3-[(2S)-2-aminobutyl]-5-thiophen-2-yl-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 95849400 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 3-[(2S)-2-aminobutyl]-5-thiophen-2-yl-1,3,4-oxadiazol-2-one |
| SMILES | CC[C@H](N)Cn1nc(-c2cccs2)oc1=O |
| InChI | InChI=1S/C10H13N3O2S/c1-2-7(11)6-13-10(14)15-9(12-13)8-4-3-5-16-8/h3-5,7H,2,6,11H2,1H3/t7-/m0/s1 |
| InChIKey | NEUBFFVEKQJMCH-ZETCQYMHSA-N |
| XLogP | 1.30 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |