C15H12N4O4S — CID 34006331
[4-[2-(2-oxo-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)acetyl]phenyl]urea (PubChem CID 34006331) has the molecular formula C15H12N4O4S and a molecular weight of 344.35 g/mol. Its IUPAC name is [4-[2-(2-oxo-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)acetyl]phenyl]urea.
| Compound Name | [4-[2-(2-oxo-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)acetyl]phenyl]urea |
|---|---|
| PubChem CID | 34006331 |
| Molecular Formula | C15H12N4O4S |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | [4-[2-(2-oxo-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)acetyl]phenyl]urea |
| SMILES | NC(=O)Nc1ccc(C(=O)Cn2nc(-c3cccs3)oc2=O)cc1 |
| InChI | InChI=1S/C15H12N4O4S/c16-14(21)17-10-5-3-9(4-6-10)11(20)8-19-15(22)23-13(18-19)12-2-1-7-24-12/h1-7H,8H2,(H3,16,17,21) |
| InChIKey | IFBVAEXDJLSFAY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 120.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |