C20H20N4O4S — CID 2108689
5-(1,3-benzodioxol-5-yl)-3-[[4-(4-hydroxyphenyl)piperazin-1-yl]methyl]-1,3,4-oxadiazole-2-thione (PubChem CID 2108689) has the molecular formula C20H20N4O4S and a molecular weight of 412.47 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-3-[[4-(4-hydroxyphenyl)piperazin-1-yl]methyl]-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-3-[[4-(4-hydroxyphenyl)piperazin-1-yl]methyl]-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 2108689 |
| Molecular Formula | C20H20N4O4S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-3-[[4-(4-hydroxyphenyl)piperazin-1-yl]methyl]-1,3,4-oxadiazole-2-thione |
| SMILES | Oc1ccc(N2CCN(Cn3nc(-c4ccc5c(c4)OCO5)oc3=S)CC2)cc1 |
| InChI | InChI=1S/C20H20N4O4S/c25-16-4-2-15(3-5-16)23-9-7-22(8-10-23)12-24-20(29)28-19(21-24)14-1-6-17-18(11-14)27-13-26-17/h1-6,11,25H,7-10,12-13H2 |
| InChIKey | SRVRZTNIZQYPAF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|