C16H20N6S+2 — CID 9280406
2-[(4-pyridin-1-ium-4-ylpiperazin-1-ium-1-yl)methyl]-[1,2,4]triazolo[4,3-a]pyridine-3-thione (PubChem CID 9280406) has the molecular formula C16H20N6S+2 and a molecular weight of 328.44 g/mol. Its IUPAC name is 2-[(4-pyridin-1-ium-4-ylpiperazin-1-ium-1-yl)methyl]-[1,2,4]triazolo[4,3-a]pyridine-3-thione.
| Compound Name | 2-[(4-pyridin-1-ium-4-ylpiperazin-1-ium-1-yl)methyl]-[1,2,4]triazolo[4,3-a]pyridine-3-thione |
|---|---|
| PubChem CID | 9280406 |
| Molecular Formula | C16H20N6S+2 |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 2-[(4-pyridin-1-ium-4-ylpiperazin-1-ium-1-yl)methyl]-[1,2,4]triazolo[4,3-a]pyridine-3-thione |
| SMILES | S=c1n(C[NH+]2CCN(c3cc[nH+]cc3)CC2)nc2ccccn12 |
| InChI | InChI=1S/C16H18N6S/c23-16-21-8-2-1-3-15(21)18-22(16)13-19-9-11-20(12-10-19)14-4-6-17-7-5-14/h1-8H,9-13H2/p+2 |
| InChIKey | UOXXMJKPKYXFKA-UHFFFAOYSA-P |
| XLogP | 0.04 |
| TPSA | 44.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|