C13H21N5S+2 — CID 2372774
2-[(4-methyl-1,4-diazepane-1,4-diium-1-yl)methyl]-[1,2,4]triazolo[4,3-a]pyridine-3-thione (PubChem CID 2372774) has the molecular formula C13H21N5S+2 and a molecular weight of 279.41 g/mol. Its IUPAC name is 2-[(4-methyl-1,4-diazepane-1,4-diium-1-yl)methyl]-[1,2,4]triazolo[4,3-a]pyridine-3-thione.
| Compound Name | 2-[(4-methyl-1,4-diazepane-1,4-diium-1-yl)methyl]-[1,2,4]triazolo[4,3-a]pyridine-3-thione |
|---|---|
| PubChem CID | 2372774 |
| Molecular Formula | C13H21N5S+2 |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2-[(4-methyl-1,4-diazepane-1,4-diium-1-yl)methyl]-[1,2,4]triazolo[4,3-a]pyridine-3-thione |
| SMILES | C[NH+]1CCC[NH+](Cn2nc3ccccn3c2=S)CC1 |
| InChI | InChI=1S/C13H19N5S/c1-15-6-4-7-16(10-9-15)11-18-13(19)17-8-3-2-5-12(17)14-18/h2-3,5,8H,4,6-7,9-11H2,1H3/p+2 |
| InChIKey | PCAJGDKVSYHYQP-UHFFFAOYSA-P |
| XLogP | -1.37 |
| TPSA | 31.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|