C20H25N4O2S+ — CID 9319401
2-[(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)methyl]-[1,2,4]triazolo[4,3-a]pyridine-3-thione (PubChem CID 9319401) has the molecular formula C20H25N4O2S+ and a molecular weight of 385.51 g/mol. Its IUPAC name is 2-[(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)methyl]-[1,2,4]triazolo[4,3-a]pyridine-3-thione.
| Compound Name | 2-[(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)methyl]-[1,2,4]triazolo[4,3-a]pyridine-3-thione |
|---|---|
| PubChem CID | 9319401 |
| Molecular Formula | C20H25N4O2S+ |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 2-[(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)methyl]-[1,2,4]triazolo[4,3-a]pyridine-3-thione |
| SMILES | CCOc1cc2c(cc1OCC)C[NH+](Cn1nc3ccccn3c1=S)CC2 |
| InChI | InChI=1S/C20H24N4O2S/c1-3-25-17-11-15-8-10-22(13-16(15)12-18(17)26-4-2)14-24-20(27)23-9-6-5-7-19(23)21-24/h5-7,9,11-12H,3-4,8,10,13-14H2,1-2H3/p+1 |
| InChIKey | TUXUBMFDOZRMRL-UHFFFAOYSA-O |
| XLogP | 2.26 |
| TPSA | 45.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|