C21H25N4O3+ — CID 9319452
3-[(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)methyl]-1,2,3-benzotriazin-4-one (PubChem CID 9319452) has the molecular formula C21H25N4O3+ and a molecular weight of 381.46 g/mol. Its IUPAC name is 3-[(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)methyl]-1,2,3-benzotriazin-4-one.
| Compound Name | 3-[(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)methyl]-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 9319452 |
| Molecular Formula | C21H25N4O3+ |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 3-[(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)methyl]-1,2,3-benzotriazin-4-one |
| SMILES | CCOc1cc2c(cc1OCC)C[NH+](Cn1nnc3ccccc3c1=O)CC2 |
| InChI | InChI=1S/C21H24N4O3/c1-3-27-19-11-15-9-10-24(13-16(15)12-20(19)28-4-2)14-25-21(26)17-7-5-6-8-18(17)22-23-25/h5-8,11-12H,3-4,9-10,13-14H2,1-2H3/p+1 |
| InChIKey | HEZRYDKJFPIRQR-UHFFFAOYSA-O |
| XLogP | 1.19 |
| TPSA | 70.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |