C23H29ClN4O3 — CID 15940841
3-[5-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-1,2,3-benzotriazin-4-one;hydrochloride (PubChem CID 15940841) has the molecular formula C23H29ClN4O3 and a molecular weight of 444.96 g/mol. Its IUPAC name is 3-[5-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-1,2,3-benzotriazin-4-one;hydrochloride.
| Compound Name | 3-[5-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-1,2,3-benzotriazin-4-one;hydrochloride |
|---|---|
| PubChem CID | 15940841 |
| Molecular Formula | C23H29ClN4O3 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 3-[5-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-1,2,3-benzotriazin-4-one;hydrochloride |
| SMILES | COc1cc2c(cc1OC)CN(CCCCCn1nnc3ccccc3c1=O)CC2.Cl |
| InChI | InChI=1S/C23H28N4O3.ClH/c1-29-21-14-17-10-13-26(16-18(17)15-22(21)30-2)11-6-3-7-12-27-23(28)19-8-4-5-9-20(19)24-25-27;/h4-5,8-9,14-15H,3,6-7,10-13,16H2,1-2H3;1H |
| InChIKey | RYYZUYNUYQGFFQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|