C17H25NO3 — CID 106801127
6-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)hexan-3-one (PubChem CID 106801127) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 6-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)hexan-3-one.
| Compound Name | 6-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)hexan-3-one |
|---|---|
| PubChem CID | 106801127 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 6-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)hexan-3-one |
| SMILES | CCC(=O)CCCN1CCc2cc(OC)c(OC)cc2C1 |
| InChI | InChI=1S/C17H25NO3/c1-4-15(19)6-5-8-18-9-7-13-10-16(20-2)17(21-3)11-14(13)12-18/h10-11H,4-9,12H2,1-3H3 |
| InChIKey | MUBVSYCNRMMQPM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |