C18H29NO3 — CID 162476741
6,7-dimethoxy-2-[3-[(2-methylpropan-2-yl)oxy]propyl]-3,4-dihydro-1H-isoquinoline (PubChem CID 162476741) has the molecular formula C18H29NO3 and a molecular weight of 307.43 g/mol. Its IUPAC name is 6,7-dimethoxy-2-[3-[(2-methylpropan-2-yl)oxy]propyl]-3,4-dihydro-1H-isoquinoline.
| Compound Name | 6,7-dimethoxy-2-[3-[(2-methylpropan-2-yl)oxy]propyl]-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 162476741 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | 6,7-dimethoxy-2-[3-[(2-methylpropan-2-yl)oxy]propyl]-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1cc2c(cc1OC)CN(CCCOC(C)(C)C)CC2 |
| InChI | InChI=1S/C18H29NO3/c1-18(2,3)22-10-6-8-19-9-7-14-11-16(20-4)17(21-5)12-15(14)13-19/h11-12H,6-10,13H2,1-5H3 |
| InChIKey | BCHFZXQOJGNVKX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|