C18H27N4S+ — CID 9193591
4-ethyl-5-(2-methylphenyl)-2-[(4-methylpiperidin-1-ium-1-yl)methyl]-1,2,4-triazole-3-thione (PubChem CID 9193591) has the molecular formula C18H27N4S+ and a molecular weight of 331.51 g/mol. Its IUPAC name is 4-ethyl-5-(2-methylphenyl)-2-[(4-methylpiperidin-1-ium-1-yl)methyl]-1,2,4-triazole-3-thione.
| Compound Name | 4-ethyl-5-(2-methylphenyl)-2-[(4-methylpiperidin-1-ium-1-yl)methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 9193591 |
| Molecular Formula | C18H27N4S+ |
| Molecular Weight | 331.51 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 4-ethyl-5-(2-methylphenyl)-2-[(4-methylpiperidin-1-ium-1-yl)methyl]-1,2,4-triazole-3-thione |
| SMILES | CCn1c(-c2ccccc2C)nn(C[NH+]2CCC(C)CC2)c1=S |
| InChI | InChI=1S/C18H26N4S/c1-4-21-17(16-8-6-5-7-15(16)3)19-22(18(21)23)13-20-11-9-14(2)10-12-20/h5-8,14H,4,9-13H2,1-3H3/p+1 |
| InChIKey | HPVUOZFCTZYWKR-UHFFFAOYSA-O |
| XLogP | 2.68 |
| TPSA | 27.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|