C21H34N4S+2 — CID 6980475
1,3-bis[(4-methylpiperidin-1-ium-1-yl)methyl]benzimidazole-2-thione (PubChem CID 6980475) has the molecular formula C21H34N4S+2 and a molecular weight of 374.60 g/mol. Its IUPAC name is 1,3-bis[(4-methylpiperidin-1-ium-1-yl)methyl]benzimidazole-2-thione.
| Compound Name | 1,3-bis[(4-methylpiperidin-1-ium-1-yl)methyl]benzimidazole-2-thione |
|---|---|
| PubChem CID | 6980475 |
| Molecular Formula | C21H34N4S+2 |
| Molecular Weight | 374.60 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 1,3-bis[(4-methylpiperidin-1-ium-1-yl)methyl]benzimidazole-2-thione |
| SMILES | CC1CC[NH+](Cn2c(=S)n(C[NH+]3CCC(C)CC3)c3ccccc32)CC1 |
| InChI | InChI=1S/C21H32N4S/c1-17-7-11-22(12-8-17)15-24-19-5-3-4-6-20(19)25(21(24)26)16-23-13-9-18(2)10-14-23/h3-6,17-18H,7-16H2,1-2H3/p+2 |
| InChIKey | CLXCLHDSNCCGRK-UHFFFAOYSA-P |
| XLogP | 1.72 |
| TPSA | 18.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.60 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|