C13H19N4S2+ — CID 7480093
2-[(4-methylpiperidin-1-ium-1-yl)methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione (PubChem CID 7480093) has the molecular formula C13H19N4S2+ and a molecular weight of 295.46 g/mol. Its IUPAC name is 2-[(4-methylpiperidin-1-ium-1-yl)methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione.
| Compound Name | 2-[(4-methylpiperidin-1-ium-1-yl)methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 7480093 |
| Molecular Formula | C13H19N4S2+ |
| Molecular Weight | 295.46 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 2-[(4-methylpiperidin-1-ium-1-yl)methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione |
| SMILES | CC1CC[NH+](Cn2[nH]c(-c3cccs3)nc2=S)CC1 |
| InChI | InChI=1S/C13H18N4S2/c1-10-4-6-16(7-5-10)9-17-13(18)14-12(15-17)11-3-2-8-19-11/h2-3,8,10H,4-7,9H2,1H3,(H,14,15,18)/p+1 |
| InChIKey | IIPCZDQFVXZXPM-UHFFFAOYSA-O |
| XLogP | 1.94 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|