C18H19N4S2+ — CID 7911294
2-[(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione (PubChem CID 7911294) has the molecular formula C18H19N4S2+ and a molecular weight of 355.51 g/mol. Its IUPAC name is 2-[(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione.
| Compound Name | 2-[(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 7911294 |
| Molecular Formula | C18H19N4S2+ |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 2-[(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione |
| SMILES | S=c1nc(-c2cccs2)[nH]n1C[NH+]1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C18H18N4S2/c23-18-19-17(16-7-4-12-24-16)20-22(18)13-21-10-8-15(9-11-21)14-5-2-1-3-6-14/h1-8,12H,9-11,13H2,(H,19,20,23)/p+1 |
| InChIKey | OAYSOUSCLYRCJN-UHFFFAOYSA-O |
| XLogP | 3.00 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|