C13H18N4OS2 — CID 92510205
2-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione (PubChem CID 92510205) has the molecular formula C13H18N4OS2 and a molecular weight of 310.45 g/mol. Its IUPAC name is 2-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione.
| Compound Name | 2-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 92510205 |
| Molecular Formula | C13H18N4OS2 |
| Molecular Weight | 310.45 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 2-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione |
| SMILES | C[C@@H]1CN(Cn2[nH]c(-c3cccs3)nc2=S)C[C@@H](C)O1 |
| InChI | InChI=1S/C13H18N4OS2/c1-9-6-16(7-10(2)18-9)8-17-13(19)14-12(15-17)11-4-3-5-20-11/h3-5,9-10H,6-8H2,1-2H3,(H,14,15,19)/t9-,10-/m1/s1 |
| InChIKey | HDBPBFJWCNFNMO-NXEZZACHSA-N |
| XLogP | 2.74 |
| TPSA | 46.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|