C17H26N6OS2 — CID 9245127
N-tert-butyl-2-[4-[(3-sulfanylidene-5-thiophen-2-yl-1H-1,2,4-triazol-2-yl)methyl]piperazin-1-yl]acetamide (PubChem CID 9245127) has the molecular formula C17H26N6OS2 and a molecular weight of 394.57 g/mol. Its IUPAC name is N-tert-butyl-2-[4-[(3-sulfanylidene-5-thiophen-2-yl-1H-1,2,4-triazol-2-yl)methyl]piperazin-1-yl]acetamide.
| Compound Name | N-tert-butyl-2-[4-[(3-sulfanylidene-5-thiophen-2-yl-1H-1,2,4-triazol-2-yl)methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 9245127 |
| Molecular Formula | C17H26N6OS2 |
| Molecular Weight | 394.57 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | N-tert-butyl-2-[4-[(3-sulfanylidene-5-thiophen-2-yl-1H-1,2,4-triazol-2-yl)methyl]piperazin-1-yl]acetamide |
| SMILES | CC(C)(C)NC(=O)CN1CCN(Cn2[nH]c(-c3cccs3)nc2=S)CC1 |
| InChI | InChI=1S/C17H26N6OS2/c1-17(2,3)19-14(24)11-21-6-8-22(9-7-21)12-23-16(25)18-15(20-23)13-5-4-10-26-13/h4-5,10H,6-9,11-12H2,1-3H3,(H,19,24)(H,18,20,25) |
| InChIKey | VZAMLSMNHWESDX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 69.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.57 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|