C17H17Cl2N5O2S3 — CID 27076012
2-[[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione (PubChem CID 27076012) has the molecular formula C17H17Cl2N5O2S3 and a molecular weight of 490.46 g/mol. Its IUPAC name is 2-[[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione.
| Compound Name | 2-[[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 27076012 |
| Molecular Formula | C17H17Cl2N5O2S3 |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 488.99 |
| IUPAC Name | 2-[[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione |
| SMILES | O=S(=O)(c1cccc(Cl)c1Cl)N1CCN(Cn2[nH]c(-c3cccs3)nc2=S)CC1 |
| InChI | InChI=1S/C17H17Cl2N5O2S3/c18-12-3-1-5-14(15(12)19)29(25,26)23-8-6-22(7-9-23)11-24-17(27)20-16(21-24)13-4-2-10-28-13/h1-5,10H,6-9,11H2,(H,20,21,27) |
| InChIKey | NGWMESUHWIYNJM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|