C19H23N5OS2 — CID 9325351
2-[[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione (PubChem CID 9325351) has the molecular formula C19H23N5OS2 and a molecular weight of 401.56 g/mol. Its IUPAC name is 2-[[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione.
| Compound Name | 2-[[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 9325351 |
| Molecular Formula | C19H23N5OS2 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 2-[[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione |
| SMILES | COc1ccc(CN2CCN(Cn3[nH]c(-c4cccs4)nc3=S)CC2)cc1 |
| InChI | InChI=1S/C19H23N5OS2/c1-25-16-6-4-15(5-7-16)13-22-8-10-23(11-9-22)14-24-19(26)20-18(21-24)17-3-2-12-27-17/h2-7,12H,8-11,13-14H2,1H3,(H,20,21,26) |
| InChIKey | NSRNWXPRLNXSOW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 49.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|