C19H23ClIN5O — CID 139051943
2-[3-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]propyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one iodide (PubChem CID 139051943) has the molecular formula C19H23ClIN5O and a molecular weight of 499.78 g/mol. Its IUPAC name is 2-[3-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]propyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one iodide.
| Compound Name | 2-[3-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]propyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one iodide |
|---|---|
| PubChem CID | 139051943 |
| Molecular Formula | C19H23ClIN5O |
| Molecular Weight | 499.78 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | 2-[3-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]propyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one iodide |
| SMILES | O=c1n(CCC[NH+]2CCN(c3cccc(Cl)c3)CC2)nc2ccccn12.[I-] |
| InChI | InChI=1S/C19H22ClN5O.HI/c20-16-5-3-6-17(15-16)23-13-11-22(12-14-23)8-4-10-25-19(26)24-9-2-1-7-18(24)21-25;/h1-3,5-7,9,15H,4,8,10-14H2;1H |
| InChIKey | HJIMEWUYEIYLFH-UHFFFAOYSA-N |
| XLogP | -2.05 |
| TPSA | 46.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.78 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|