C38H45Cl3N10O2 — CID 160735622
bis(2-[3-[4-(3-chlorophenyl)piperazin-1-yl]-1,1,3,3-tetradeuteriopropyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one);hydrochloride (PubChem CID 160735622) has the molecular formula C38H45Cl3N10O2 and a molecular weight of 788.25 g/mol. Its IUPAC name is bis(2-[3-[4-(3-chlorophenyl)piperazin-1-yl]-1,1,3,3-tetradeuteriopropyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one);hydrochloride.
| Compound Name | bis(2-[3-[4-(3-chlorophenyl)piperazin-1-yl]-1,1,3,3-tetradeuteriopropyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one);hydrochloride |
|---|---|
| PubChem CID | 160735622 |
| Molecular Formula | C38H45Cl3N10O2 |
| Molecular Weight | 788.25 g/mol |
| Exact Mass | 786.33 |
| IUPAC Name | bis(2-[3-[4-(3-chlorophenyl)piperazin-1-yl]-1,1,3,3-tetradeuteriopropyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one);hydrochloride |
| SMILES | Cl.[2H]C([2H])(CC([2H])([2H])n1nc2ccccn2c1=O)N1CCN(c2cccc(Cl)c2)CC1.[2H]C([2H])(CC([2H])([2H])n1nc2ccccn2c1=O)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/2C19H22ClN5O.ClH/c2*20-16-5-3-6-17(15-16)23-13-11-22(12-14-23)8-4-10-25-19(26)24-9-2-1-7-18(24)21-25;/h2*1-3,5-7,9,15H,4,8,10-14H2;1H/i2*8D2,10D2; |
| InChIKey | UETSEEXVCKMWSG-HZKRZQLGSA-N |
| XLogP | 5.15 |
| TPSA | 91.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.25 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |