C21H27N5S+2 — CID 9243485
1-(2,3-dimethylphenyl)-3-[(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)methyl]imidazole-2-thione (PubChem CID 9243485) has the molecular formula C21H27N5S+2 and a molecular weight of 381.55 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-[(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)methyl]imidazole-2-thione.
| Compound Name | 1-(2,3-dimethylphenyl)-3-[(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)methyl]imidazole-2-thione |
|---|---|
| PubChem CID | 9243485 |
| Molecular Formula | C21H27N5S+2 |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-[(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)methyl]imidazole-2-thione |
| SMILES | Cc1cccc(-n2ccn(C[NH+]3CCN(c4cccc[nH+]4)CC3)c2=S)c1C |
| InChI | InChI=1S/C21H25N5S/c1-17-6-5-7-19(18(17)2)26-15-14-25(21(26)27)16-23-10-12-24(13-11-23)20-8-3-4-9-22-20/h3-9,14-15H,10-13,16H2,1-2H3/p+2 |
| InChIKey | PGHFBKHQSOBKIO-UHFFFAOYSA-P |
| XLogP | 1.80 |
| TPSA | 31.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|