C20H24ClN5S+2 — CID 9243434
1-(3-chloro-2-methylphenyl)-3-[(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)methyl]imidazole-2-thione (PubChem CID 9243434) has the molecular formula C20H24ClN5S+2 and a molecular weight of 401.97 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-3-[(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)methyl]imidazole-2-thione.
| Compound Name | 1-(3-chloro-2-methylphenyl)-3-[(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)methyl]imidazole-2-thione |
|---|---|
| PubChem CID | 9243434 |
| Molecular Formula | C20H24ClN5S+2 |
| Molecular Weight | 401.97 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-3-[(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)methyl]imidazole-2-thione |
| SMILES | Cc1c(Cl)cccc1-n1ccn(C[NH+]2CCN(c3cccc[nH+]3)CC2)c1=S |
| InChI | InChI=1S/C20H22ClN5S/c1-16-17(21)5-4-6-18(16)26-14-13-25(20(26)27)15-23-9-11-24(12-10-23)19-7-2-3-8-22-19/h2-8,13-14H,9-12,15H2,1H3/p+2 |
| InChIKey | GRDIYZQPHZGNNR-UHFFFAOYSA-P |
| XLogP | 2.15 |
| TPSA | 31.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.97 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|