C20H25N5S+2 — CID 9243478
1-(2-methylphenyl)-3-[(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)methyl]imidazole-2-thione (PubChem CID 9243478) has the molecular formula C20H25N5S+2 and a molecular weight of 367.52 g/mol. Its IUPAC name is 1-(2-methylphenyl)-3-[(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)methyl]imidazole-2-thione.
| Compound Name | 1-(2-methylphenyl)-3-[(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)methyl]imidazole-2-thione |
|---|---|
| PubChem CID | 9243478 |
| Molecular Formula | C20H25N5S+2 |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 1-(2-methylphenyl)-3-[(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)methyl]imidazole-2-thione |
| SMILES | Cc1ccccc1-n1ccn(C[NH+]2CCN(c3cccc[nH+]3)CC2)c1=S |
| InChI | InChI=1S/C20H23N5S/c1-17-6-2-3-7-18(17)25-15-14-24(20(25)26)16-22-10-12-23(13-11-22)19-8-4-5-9-21-19/h2-9,14-15H,10-13,16H2,1H3/p+2 |
| InChIKey | GFKRKDKPMHAGFW-UHFFFAOYSA-P |
| XLogP | 1.49 |
| TPSA | 31.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|