C21H26ClN3O3 — CID 46139157
ethyl 1-[1-(3-chlorophenyl)-5-propan-2-ylpyrazole-4-carbonyl]piperidine-3-carboxylate (PubChem CID 46139157) has the molecular formula C21H26ClN3O3 and a molecular weight of 403.91 g/mol. Its IUPAC name is ethyl 1-[1-(3-chlorophenyl)-5-propan-2-ylpyrazole-4-carbonyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[1-(3-chlorophenyl)-5-propan-2-ylpyrazole-4-carbonyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 46139157 |
| Molecular Formula | C21H26ClN3O3 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | ethyl 1-[1-(3-chlorophenyl)-5-propan-2-ylpyrazole-4-carbonyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)c2cnn(-c3cccc(Cl)c3)c2C(C)C)C1 |
| InChI | InChI=1S/C21H26ClN3O3/c1-4-28-21(27)15-7-6-10-24(13-15)20(26)18-12-23-25(19(18)14(2)3)17-9-5-8-16(22)11-17/h5,8-9,11-12,14-15H,4,6-7,10,13H2,1-3H3 |
| InChIKey | ILPQYIIREYPUMN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |