C21H22FN3O2S2 — CID 2496966
1-(4-fluorophenyl)-4-[[4-[[(2S)-oxolan-2-yl]methyl]-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]butan-1-one (PubChem CID 2496966) has the molecular formula C21H22FN3O2S2 and a molecular weight of 431.56 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-[[4-[[(2S)-oxolan-2-yl]methyl]-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]butan-1-one.
| Compound Name | 1-(4-fluorophenyl)-4-[[4-[[(2S)-oxolan-2-yl]methyl]-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]butan-1-one |
|---|---|
| PubChem CID | 2496966 |
| Molecular Formula | C21H22FN3O2S2 |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 1-(4-fluorophenyl)-4-[[4-[[(2S)-oxolan-2-yl]methyl]-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]butan-1-one |
| SMILES | O=C(CCCSc1nnc(-c2cccs2)n1C[C@@H]1CCCO1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H22FN3O2S2/c22-16-9-7-15(8-10-16)18(26)5-2-13-29-21-24-23-20(19-6-3-12-28-19)25(21)14-17-4-1-11-27-17/h3,6-10,12,17H,1-2,4-5,11,13-14H2/t17-/m0/s1 |
| InChIKey | INHNFMXFKVMNHK-KRWDZBQOSA-N |
| XLogP | 5.08 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|