C21H23N3O3S2 — CID 2621470
1-[2-[2-[[4-[[(2R)-oxolan-2-yl]methyl]-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]ethoxy]phenyl]ethanone (PubChem CID 2621470) has the molecular formula C21H23N3O3S2 and a molecular weight of 429.57 g/mol. Its IUPAC name is 1-[2-[2-[[4-[[(2R)-oxolan-2-yl]methyl]-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]ethoxy]phenyl]ethanone.
| Compound Name | 1-[2-[2-[[4-[[(2R)-oxolan-2-yl]methyl]-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]ethoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 2621470 |
| Molecular Formula | C21H23N3O3S2 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 1-[2-[2-[[4-[[(2R)-oxolan-2-yl]methyl]-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]ethoxy]phenyl]ethanone |
| SMILES | CC(=O)c1ccccc1OCCSc1nnc(-c2cccs2)n1C[C@H]1CCCO1 |
| InChI | InChI=1S/C21H23N3O3S2/c1-15(25)17-7-2-3-8-18(17)27-11-13-29-21-23-22-20(19-9-5-12-28-19)24(21)14-16-6-4-10-26-16/h2-3,5,7-9,12,16H,4,6,10-11,13-14H2,1H3/t16-/m1/s1 |
| InChIKey | HQNDFXRWYMMTDJ-MRXNPFEDSA-N |
| XLogP | 4.56 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|