C21H24N4S2 — CID 55860198
5-benzyl-4-phenyl-2-(1,4-thiazepan-4-ylmethyl)-1,2,4-triazole-3-thione (PubChem CID 55860198) has the molecular formula C21H24N4S2 and a molecular weight of 396.58 g/mol. Its IUPAC name is 5-benzyl-4-phenyl-2-(1,4-thiazepan-4-ylmethyl)-1,2,4-triazole-3-thione.
| Compound Name | 5-benzyl-4-phenyl-2-(1,4-thiazepan-4-ylmethyl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 55860198 |
| Molecular Formula | C21H24N4S2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 5-benzyl-4-phenyl-2-(1,4-thiazepan-4-ylmethyl)-1,2,4-triazole-3-thione |
| SMILES | S=c1n(CN2CCCSCC2)nc(Cc2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C21H24N4S2/c26-21-24(17-23-12-7-14-27-15-13-23)22-20(16-18-8-3-1-4-9-18)25(21)19-10-5-2-6-11-19/h1-6,8-11H,7,12-17H2 |
| InChIKey | SKSCTNCBIIHBEK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 25.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|