C24H29FN6S — CID 55430242
2-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-4-phenyl-5-(pyrrolidin-1-ylmethyl)-1,2,4-triazole-3-thione (PubChem CID 55430242) has the molecular formula C24H29FN6S and a molecular weight of 452.60 g/mol. Its IUPAC name is 2-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-4-phenyl-5-(pyrrolidin-1-ylmethyl)-1,2,4-triazole-3-thione.
| Compound Name | 2-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-4-phenyl-5-(pyrrolidin-1-ylmethyl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 55430242 |
| Molecular Formula | C24H29FN6S |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 2-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-4-phenyl-5-(pyrrolidin-1-ylmethyl)-1,2,4-triazole-3-thione |
| SMILES | Fc1ccc(N2CCN(Cn3nc(CN4CCCC4)n(-c4ccccc4)c3=S)CC2)cc1 |
| InChI | InChI=1S/C24H29FN6S/c25-20-8-10-21(11-9-20)29-16-14-28(15-17-29)19-30-24(32)31(22-6-2-1-3-7-22)23(26-30)18-27-12-4-5-13-27/h1-3,6-11H,4-5,12-19H2 |
| InChIKey | MQKHNJYXRGCJOI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 32.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|