C18H25N5S — CID 31581228
2-[(4-phenylpiperazin-1-yl)methyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine-3-thione (PubChem CID 31581228) has the molecular formula C18H25N5S and a molecular weight of 343.50 g/mol. Its IUPAC name is 2-[(4-phenylpiperazin-1-yl)methyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine-3-thione.
| Compound Name | 2-[(4-phenylpiperazin-1-yl)methyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine-3-thione |
|---|---|
| PubChem CID | 31581228 |
| Molecular Formula | C18H25N5S |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 2-[(4-phenylpiperazin-1-yl)methyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine-3-thione |
| SMILES | S=c1n(CN2CCN(c3ccccc3)CC2)nc2n1CCCCC2 |
| InChI | InChI=1S/C18H25N5S/c24-18-22-10-6-2-5-9-17(22)19-23(18)15-20-11-13-21(14-12-20)16-7-3-1-4-8-16/h1,3-4,7-8H,2,5-6,9-15H2 |
| InChIKey | HPSVIPIFWBYGKR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 29.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|