C16H20Cl2N4S — CID 27080637
2-[[(2,3-dichlorophenyl)methyl-methylamino]methyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine-3-thione (PubChem CID 27080637) has the molecular formula C16H20Cl2N4S and a molecular weight of 371.34 g/mol. Its IUPAC name is 2-[[(2,3-dichlorophenyl)methyl-methylamino]methyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine-3-thione.
| Compound Name | 2-[[(2,3-dichlorophenyl)methyl-methylamino]methyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine-3-thione |
|---|---|
| PubChem CID | 27080637 |
| Molecular Formula | C16H20Cl2N4S |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 2-[[(2,3-dichlorophenyl)methyl-methylamino]methyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine-3-thione |
| SMILES | CN(Cc1cccc(Cl)c1Cl)Cn1nc2n(c1=S)CCCCC2 |
| InChI | InChI=1S/C16H20Cl2N4S/c1-20(10-12-6-5-7-13(17)15(12)18)11-22-16(23)21-9-4-2-3-8-14(21)19-22/h5-7H,2-4,8-11H2,1H3 |
| InChIKey | IESLQKZQAOCJGX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 25.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|