C14H20ClN4S2+ — CID 9171782
(5-chlorothiophen-2-yl)methyl-methyl-[(3-sulfanylidene-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-2-yl)methyl]azanium (PubChem CID 9171782) has the molecular formula C14H20ClN4S2+ and a molecular weight of 343.93 g/mol. Its IUPAC name is (5-chlorothiophen-2-yl)methyl-methyl-[(3-sulfanylidene-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-2-yl)methyl]azanium.
| Compound Name | (5-chlorothiophen-2-yl)methyl-methyl-[(3-sulfanylidene-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 9171782 |
| Molecular Formula | C14H20ClN4S2+ |
| Molecular Weight | 343.93 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | (5-chlorothiophen-2-yl)methyl-methyl-[(3-sulfanylidene-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-2-yl)methyl]azanium |
| SMILES | C[NH+](Cc1ccc(Cl)s1)Cn1nc2n(c1=S)CCCCC2 |
| InChI | InChI=1S/C14H19ClN4S2/c1-17(9-11-6-7-12(15)21-11)10-19-14(20)18-8-4-2-3-5-13(18)16-19/h6-7H,2-5,8-10H2,1H3/p+1 |
| InChIKey | JLUPMFBUGWGLNK-UHFFFAOYSA-O |
| XLogP | 2.53 |
| TPSA | 27.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.93 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|