C16H22N4S2 — CID 9321146
2-[[(4R)-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine-3-thione (PubChem CID 9321146) has the molecular formula C16H22N4S2 and a molecular weight of 334.51 g/mol. Its IUPAC name is 2-[[(4R)-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine-3-thione.
| Compound Name | 2-[[(4R)-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine-3-thione |
|---|---|
| PubChem CID | 9321146 |
| Molecular Formula | C16H22N4S2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 2-[[(4R)-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine-3-thione |
| SMILES | C[C@@H]1c2ccsc2CCN1Cn1nc2n(c1=S)CCCCC2 |
| InChI | InChI=1S/C16H22N4S2/c1-12-13-7-10-22-14(13)6-9-18(12)11-20-16(21)19-8-4-2-3-5-15(19)17-20/h7,10,12H,2-6,8-9,11H2,1H3/t12-/m1/s1 |
| InChIKey | NXAXZGRAJOQXGP-GFCCVEGCSA-N |
| XLogP | 3.78 |
| TPSA | 25.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|