C18H19N3OS2 — CID 9321348
5-benzyl-3-[[(4S)-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methyl]-1,3,4-oxadiazole-2-thione (PubChem CID 9321348) has the molecular formula C18H19N3OS2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 5-benzyl-3-[[(4S)-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methyl]-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-benzyl-3-[[(4S)-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methyl]-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 9321348 |
| Molecular Formula | C18H19N3OS2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 5-benzyl-3-[[(4S)-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methyl]-1,3,4-oxadiazole-2-thione |
| SMILES | C[C@H]1c2ccsc2CCN1Cn1nc(Cc2ccccc2)oc1=S |
| InChI | InChI=1S/C18H19N3OS2/c1-13-15-8-10-24-16(15)7-9-20(13)12-21-18(23)22-17(19-21)11-14-5-3-2-4-6-14/h2-6,8,10,13H,7,9,11-12H2,1H3/t13-/m0/s1 |
| InChIKey | ZSWIBILJBXFUPR-ZDUSSCGKSA-N |
| XLogP | 4.43 |
| TPSA | 34.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|