C15H17ClN5S2+ — CID 9171392
(5-chlorothiophen-2-yl)methyl-ethyl-[(4-phenyl-5-sulfanylidenetetrazol-1-yl)methyl]azanium (PubChem CID 9171392) has the molecular formula C15H17ClN5S2+ and a molecular weight of 366.92 g/mol. Its IUPAC name is (5-chlorothiophen-2-yl)methyl-ethyl-[(4-phenyl-5-sulfanylidenetetrazol-1-yl)methyl]azanium.
| Compound Name | (5-chlorothiophen-2-yl)methyl-ethyl-[(4-phenyl-5-sulfanylidenetetrazol-1-yl)methyl]azanium |
|---|---|
| PubChem CID | 9171392 |
| Molecular Formula | C15H17ClN5S2+ |
| Molecular Weight | 366.92 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | (5-chlorothiophen-2-yl)methyl-ethyl-[(4-phenyl-5-sulfanylidenetetrazol-1-yl)methyl]azanium |
| SMILES | CC[NH+](Cc1ccc(Cl)s1)Cn1nnn(-c2ccccc2)c1=S |
| InChI | InChI=1S/C15H16ClN5S2/c1-2-19(10-13-8-9-14(16)23-13)11-20-15(22)21(18-17-20)12-6-4-3-5-7-12/h3-9H,2,10-11H2,1H3/p+1 |
| InChIKey | JMZZZMGHEXDILT-UHFFFAOYSA-O |
| XLogP | 2.58 |
| TPSA | 40.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.92 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|