C16H19ClN5OS2+ — CID 9171413
(5-chlorothiophen-2-yl)methyl-ethyl-[[4-(4-methoxyphenyl)-5-sulfanylidenetetrazol-1-yl]methyl]azanium (PubChem CID 9171413) has the molecular formula C16H19ClN5OS2+ and a molecular weight of 396.95 g/mol. Its IUPAC name is (5-chlorothiophen-2-yl)methyl-ethyl-[[4-(4-methoxyphenyl)-5-sulfanylidenetetrazol-1-yl]methyl]azanium.
| Compound Name | (5-chlorothiophen-2-yl)methyl-ethyl-[[4-(4-methoxyphenyl)-5-sulfanylidenetetrazol-1-yl]methyl]azanium |
|---|---|
| PubChem CID | 9171413 |
| Molecular Formula | C16H19ClN5OS2+ |
| Molecular Weight | 396.95 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | (5-chlorothiophen-2-yl)methyl-ethyl-[[4-(4-methoxyphenyl)-5-sulfanylidenetetrazol-1-yl]methyl]azanium |
| SMILES | CC[NH+](Cc1ccc(Cl)s1)Cn1nnn(-c2ccc(OC)cc2)c1=S |
| InChI | InChI=1S/C16H18ClN5OS2/c1-3-20(10-14-8-9-15(17)25-14)11-21-16(24)22(19-18-21)12-4-6-13(23-2)7-5-12/h4-9H,3,10-11H2,1-2H3/p+1 |
| InChIKey | LPVROMNZCYFIOL-UHFFFAOYSA-O |
| XLogP | 2.58 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.95 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|